C30H34N2O — CID 118202383
(1S,2R,16R)-5-isoquinolin-7-yl-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine (PubChem CID 118202383) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is (1S,2R,16R)-5-isoquinolin-7-yl-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine.
| Compound Name | (1S,2R,16R)-5-isoquinolin-7-yl-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine |
|---|---|
| PubChem CID | 118202383 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (1S,2R,16R)-5-isoquinolin-7-yl-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine |
| SMILES | CN(C)C1CCC2=CC3=CCC4(C)C(c5ccc6ccncc6c5)=CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C30H34N2O/c1-28-12-10-24-17-23-6-7-25(32(2)3)18-29(23)13-14-30(24,33-29)27(28)9-8-26(28)21-5-4-20-11-15-31-19-22(20)16-21/h4-5,8,10-11,15-17,19,25,27H,6-7,9,12-14,18H2,1-3H3/t25?,27-,28?,29-,30-/m1/s1 |
| InChIKey | NZWOVRBMFQCVPJ-RJYWLNKKSA-N |
| XLogP | 6.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |