C29H32N2O3 — CID 90340117
(1S,2R,6S,12R,13R,14S,16R)-5-isoquinolin-7-yl-6-methyl-14-(methylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 90340117) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (1S,2R,6S,12R,13R,14S,16R)-5-isoquinolin-7-yl-6-methyl-14-(methylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | (1S,2R,6S,12R,13R,14S,16R)-5-isoquinolin-7-yl-6-methyl-14-(methylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 90340117 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (1S,2R,6S,12R,13R,14S,16R)-5-isoquinolin-7-yl-6-methyl-14-(methylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | CN[C@H]1C[C@@]23CC[C@@]4(O2)C(=CC[C@]2(C)C(c5ccc6ccncc6c5)=CC[C@H]24)C=C3[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H32N2O3/c1-27-9-7-20-14-22-25(32)26(33)23(30-2)15-28(22)10-11-29(20,34-28)24(27)6-5-21(27)18-4-3-17-8-12-31-16-19(17)13-18/h3-5,7-8,12-14,16,23-26,30,32-33H,6,9-11,15H2,1-2H3/t23-,24+,25+,26+,27+,28+,29+/m0/s1 |
| InChIKey | PTEYUUSZCYSFFO-TZTPJLBGSA-N |
| XLogP | 3.92 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |