C10H9NO3S — CID 15734329
5-methyl-1,1-dioxo-4-phenyl-1,2-thiazol-3-one (PubChem CID 15734329) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 5-methyl-1,1-dioxo-4-phenyl-1,2-thiazol-3-one.
| Compound Name | 5-methyl-1,1-dioxo-4-phenyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 15734329 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 5-methyl-1,1-dioxo-4-phenyl-1,2-thiazol-3-one |
| SMILES | CC1=C(c2ccccc2)C(=O)NS1(=O)=O |
| InChI | InChI=1S/C10H9NO3S/c1-7-9(8-5-3-2-4-6-8)10(12)11-15(7,13)14/h2-6H,1H3,(H,11,12) |
| InChIKey | SDJQJPYCOWLXCF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |