C5H6Cl2F4O2 — CID 157344224
4-chloro-3-[chloro(difluoro)methyl]-4,4-difluorobutane-1,3-diol (PubChem CID 157344224) has the molecular formula C5H6Cl2F4O2 and a molecular weight of 245.00 g/mol. Its IUPAC name is 4-chloro-3-[chloro(difluoro)methyl]-4,4-difluorobutane-1,3-diol.
| Compound Name | 4-chloro-3-[chloro(difluoro)methyl]-4,4-difluorobutane-1,3-diol |
|---|---|
| PubChem CID | 157344224 |
| Molecular Formula | C5H6Cl2F4O2 |
| Molecular Weight | 245.00 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 4-chloro-3-[chloro(difluoro)methyl]-4,4-difluorobutane-1,3-diol |
| SMILES | OCCC(O)(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C5H6Cl2F4O2/c6-4(8,9)3(13,1-2-12)5(7,10)11/h12-13H,1-2H2 |
| InChIKey | BGTMIBPXVHVFQF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.00 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|