C3H2Cl2F4O2 — CID 71421466
1,3-dichloro-1,1,3,3-tetrafluoropropane-2,2-diol (PubChem CID 71421466) has the molecular formula C3H2Cl2F4O2 and a molecular weight of 216.95 g/mol. Its IUPAC name is 1,3-dichloro-1,1,3,3-tetrafluoropropane-2,2-diol.
| Compound Name | 1,3-dichloro-1,1,3,3-tetrafluoropropane-2,2-diol |
|---|---|
| PubChem CID | 71421466 |
| Molecular Formula | C3H2Cl2F4O2 |
| Molecular Weight | 216.95 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | 1,3-dichloro-1,1,3,3-tetrafluoropropane-2,2-diol |
| SMILES | OC(O)(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C3H2Cl2F4O2/c4-2(6,7)1(10,11)3(5,8)9/h10-11H |
| InChIKey | DVDJRQXHRSFVHB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.95 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|