C5H4Cl3F3O2 — CID 3063337
4,4-dichloro-3-[chloro(difluoro)methyl]-4-fluoro-3-hydroxybutanal (PubChem CID 3063337) has the molecular formula C5H4Cl3F3O2 and a molecular weight of 259.44 g/mol. Its IUPAC name is 4,4-dichloro-3-[chloro(difluoro)methyl]-4-fluoro-3-hydroxybutanal.
| Compound Name | 4,4-dichloro-3-[chloro(difluoro)methyl]-4-fluoro-3-hydroxybutanal |
|---|---|
| PubChem CID | 3063337 |
| Molecular Formula | C5H4Cl3F3O2 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | 4,4-dichloro-3-[chloro(difluoro)methyl]-4-fluoro-3-hydroxybutanal |
| SMILES | O=CCC(O)(C(F)(F)Cl)C(F)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl3F3O2/c6-4(7,9)3(13,1-2-12)5(8,10)11/h2,13H,1H2 |
| InChIKey | ROAUSQYWMAOSJW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|