About 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol
2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol (PubChem CID 157345789) has the molecular formula C20H17NO2S
and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol |
| PubChem CID | 157345789 |
| Molecular Formula | C20H17NO2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol |
| SMILES | Oc1ccccc1-c1ccc[nH]1.Oc1ccccc1-c1cccs1 |
| InChI | InChI=1S/C10H9NO.C10H8OS/c12-10-6-2-1-4-8(10)9-5-3-7-11-9;11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7,11-12H;1-7,11H |
| InChIKey | BGYIVDRMMGLOAG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol?
The IUPAC name of 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol (CID 157345789) is 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol.
What is the SMILES notation for 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol?
The canonical SMILES for 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol is Oc1ccccc1-c1ccc[nH]1.Oc1ccccc1-c1cccs1.
What is the InChIKey of 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol?
The InChIKey is BGYIVDRMMGLOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C10H8OS/c12-10-6-2-1-4-8(10)9-5-3-7-11-9;11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7,11-12H;1-7,11H.
What are the key properties of 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol?
2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol has a molecular weight of 335.43 g/mol, XLogP of 5.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-2-yl)phenol;2-thiophen-2-ylphenol is sourced from PubChem (CID 157345789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).