About 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene
2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene (PubChem CID 175152597) has the molecular formula C25H19NS2
and a molecular weight of 397.57 g/mol. Its IUPAC name is 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene.
Molecular Properties
| Compound Name | 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene |
| PubChem CID | 175152597 |
| Molecular Formula | C25H19NS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene |
| SMILES | c1ccc2c(c1)Cc1ccccc1-2.c1csc(-c2cc[nH]c2-c2cccs2)c1 |
| InChI | InChI=1S/C13H10.C12H9NS2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-10(14-7-1)9-5-6-13-12(9)11-4-2-8-15-11/h1-8H,9H2;1-8,13H |
| InChIKey | TVNHOFVLGLHXQQ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene?
The IUPAC name of 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene (CID 175152597) is 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene.
What is the SMILES notation for 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene?
The canonical SMILES for 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene is c1ccc2c(c1)Cc1ccccc1-2.c1csc(-c2cc[nH]c2-c2cccs2)c1.
What is the InChIKey of 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene?
The InChIKey is TVNHOFVLGLHXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C12H9NS2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-10(14-7-1)9-5-6-13-12(9)11-4-2-8-15-11/h1-8H,9H2;1-8,13H.
What are the key properties of 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene?
2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene has a molecular weight of 397.57 g/mol, XLogP of 7.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dithiophen-2-yl-1H-pyrrole;9H-fluorene is sourced from PubChem (CID 175152597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).