C28H34N2O6 — CID 157349668
(2S)-2-[[[(2R,5S)-2-benzyl-4-oxo-5-(3-oxobutanoylamino)-6-phenylhexanoyl]amino]methyl]butanoic acid (PubChem CID 157349668) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is (2S)-2-[[[(2R,5S)-2-benzyl-4-oxo-5-(3-oxobutanoylamino)-6-phenylhexanoyl]amino]methyl]butanoic acid.
| Compound Name | (2S)-2-[[[(2R,5S)-2-benzyl-4-oxo-5-(3-oxobutanoylamino)-6-phenylhexanoyl]amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 157349668 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (2S)-2-[[[(2R,5S)-2-benzyl-4-oxo-5-(3-oxobutanoylamino)-6-phenylhexanoyl]amino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)C(CC(=O)[C@H](Cc1ccccc1)NC(=O)CC(C)=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H34N2O6/c1-3-22(28(35)36)18-29-27(34)23(15-20-10-6-4-7-11-20)17-25(32)24(30-26(33)14-19(2)31)16-21-12-8-5-9-13-21/h4-13,22-24H,3,14-18H2,1-2H3,(H,29,34)(H,30,33)(H,35,36)/t22?,23?,24-/m0/s1 |
| InChIKey | DUHHXBAKXMTZRX-VHYCJAOWSA-N |
| XLogP | 2.74 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|