C38H53BN5O9S — CID 161288654
CID 161288654 (PubChem CID 161288654) has the molecular formula C38H53BN5O9S and a molecular weight of 766.75 g/mol.
| Compound Name | CID 161288654 |
|---|---|
| PubChem CID | 161288654 |
| Molecular Formula | C38H53BN5O9S |
| Molecular Weight | 766.75 g/mol |
| Exact Mass | 766.37 |
| IUPAC Name | — |
| SMILES | CNCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)CC(Cc1ccccc1)C(=O)NC[C@H](N)C(=O)NC(CC(=O)O)C(=O)CC(CS)C(=O)O.[B] |
| InChI | InChI=1S/C38H53N5O9S.B/c1-40-17-11-3-2-10-16-34(46)42-30(19-26-14-8-5-9-15-26)32(44)20-27(18-25-12-6-4-7-13-25)36(49)41-23-29(39)37(50)43-31(22-35(47)48)33(45)21-28(24-53)38(51)52;/h4-9,12-15,27-31,40,53H,2-3,10-11,16-24,39H2,1H3,(H,41,49)(H,42,46)(H,43,50)(H,47,48)(H,51,52);/t27?,28?,29-,30-,31?;/m0./s1 |
| InChIKey | OGTFOHAPNLXKTM-GTPRLQDZSA-N |
| XLogP | 1.31 |
| TPSA | 234.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.75 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|