C24H32N2O9S — CID 158099531
7-[(5-carboxy-3-oxo-1-phenyl-6-sulfanylhexan-2-yl)carbamoyl]-2-(methylamino)-5-oxononanedioic acid (PubChem CID 158099531) has the molecular formula C24H32N2O9S and a molecular weight of 524.59 g/mol. Its IUPAC name is 7-[(5-carboxy-3-oxo-1-phenyl-6-sulfanylhexan-2-yl)carbamoyl]-2-(methylamino)-5-oxononanedioic acid.
| Compound Name | 7-[(5-carboxy-3-oxo-1-phenyl-6-sulfanylhexan-2-yl)carbamoyl]-2-(methylamino)-5-oxononanedioic acid |
|---|---|
| PubChem CID | 158099531 |
| Molecular Formula | C24H32N2O9S |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 7-[(5-carboxy-3-oxo-1-phenyl-6-sulfanylhexan-2-yl)carbamoyl]-2-(methylamino)-5-oxononanedioic acid |
| SMILES | CNC(CCC(=O)CC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)CC(CS)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H32N2O9S/c1-25-18(24(34)35)8-7-17(27)10-15(12-21(29)30)22(31)26-19(9-14-5-3-2-4-6-14)20(28)11-16(13-36)23(32)33/h2-6,15-16,18-19,25,36H,7-13H2,1H3,(H,26,31)(H,29,30)(H,32,33)(H,34,35) |
| InChIKey | HQGGACQHONNUDQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 187.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|