C32H38N4O8 — CID 157355328
bis(ethyl 6-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate);oxalic acid (PubChem CID 157355328) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is bis(ethyl 6-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate);oxalic acid.
| Compound Name | bis(ethyl 6-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate);oxalic acid |
|---|---|
| PubChem CID | 157355328 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | bis(ethyl 6-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate);oxalic acid |
| SMILES | CCOC(=O)c1ccc2[nH]c3c(c2c1)CC(N)CC3.CCOC(=O)c1ccc2[nH]c3c(c2c1)CC(N)CC3.O=C(O)C(=O)O |
| InChI | InChI=1S/2C15H18N2O2.C2H2O4/c2*1-2-19-15(18)9-3-5-13-11(7-9)12-8-10(16)4-6-14(12)17-13;3-1(4)2(5)6/h2*3,5,7,10,17H,2,4,6,8,16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HNAYYJMUSJWMAT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 210.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|