C32H36BBrF2N2O2 — CID 157356791
2-bromopyridine;2-(4-fluoro-3,5-dimethylphenyl)pyridine;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 157356791) has the molecular formula C32H36BBrF2N2O2 and a molecular weight of 609.36 g/mol. Its IUPAC name is 2-bromopyridine;2-(4-fluoro-3,5-dimethylphenyl)pyridine;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-bromopyridine;2-(4-fluoro-3,5-dimethylphenyl)pyridine;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 157356791 |
| Molecular Formula | C32H36BBrF2N2O2 |
| Molecular Weight | 609.36 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 2-bromopyridine;2-(4-fluoro-3,5-dimethylphenyl)pyridine;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Brc1ccccn1.Cc1cc(-c2ccccn2)cc(C)c1F.Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1F |
| InChI | InChI=1S/C14H20BFO2.C13H12FN.C5H4BrN/c1-9-7-11(8-10(2)12(9)16)15-17-13(3,4)14(5,6)18-15;1-9-7-11(8-10(2)13(9)14)12-5-3-4-6-15-12;6-5-3-1-2-4-7-5/h7-8H,1-6H3;3-8H,1-2H3;1-4H |
| InChIKey | BIEHBBRWJKEXCL-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.36 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|