About CID 157360990
CID 157360990 (PubChem CID 157360990) has the molecular formula C13H21BNO3
and a molecular weight of 250.13 g/mol.
Molecular Properties
| Compound Name | CID 157360990 |
| PubChem CID | 157360990 |
| Molecular Formula | C13H21BNO3 |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | — |
| SMILES | COc1nc(C)ccc1[B]OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H21BNO3/c1-9-7-8-10(11(15-9)17-6)14-18-13(4,5)12(2,3)16/h7-8,16H,1-6H3 |
| InChIKey | FFRMJJWCQOZHCV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157360990 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157360990?
The IUPAC name of CID 157360990 (CID 157360990) is not available.
What is the SMILES notation for CID 157360990?
The canonical SMILES for CID 157360990 is COc1nc(C)ccc1[B]OC(C)(C)C(C)(C)O.
What is the InChIKey of CID 157360990?
The InChIKey is FFRMJJWCQOZHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BNO3/c1-9-7-8-10(11(15-9)17-6)14-18-13(4,5)12(2,3)16/h7-8,16H,1-6H3.
What are the key properties of CID 157360990?
CID 157360990 has a molecular weight of 250.13 g/mol, XLogP of 1.21, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157360990 is sourced from PubChem (CID 157360990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).