C17H24N4O2 — CID 157365188
7-N-[2-(1,3-benzodioxol-5-yl)ethyl]-7-N,2,3-trimethyl-3,6-dihydro-2H-1,4-diazepine-5,7-diamine (PubChem CID 157365188) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 7-N-[2-(1,3-benzodioxol-5-yl)ethyl]-7-N,2,3-trimethyl-3,6-dihydro-2H-1,4-diazepine-5,7-diamine.
| Compound Name | 7-N-[2-(1,3-benzodioxol-5-yl)ethyl]-7-N,2,3-trimethyl-3,6-dihydro-2H-1,4-diazepine-5,7-diamine |
|---|---|
| PubChem CID | 157365188 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 7-N-[2-(1,3-benzodioxol-5-yl)ethyl]-7-N,2,3-trimethyl-3,6-dihydro-2H-1,4-diazepine-5,7-diamine |
| SMILES | CC1N=C(N)CC(N(C)CCc2ccc3c(c2)OCO3)=NC1C |
| InChI | InChI=1S/C17H24N4O2/c1-11-12(2)20-17(9-16(18)19-11)21(3)7-6-13-4-5-14-15(8-13)23-10-22-14/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H2,18,19) |
| InChIKey | DIPLAMIHXACXCQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |