About carbanide;3,3-dimethylheptane-1,5-dione;yttrium
carbanide;3,3-dimethylheptane-1,5-dione;yttrium (PubChem CID 157371416) has the molecular formula C10H18O2Y-2
and a molecular weight of 259.16 g/mol. Its IUPAC name is carbanide;3,3-dimethylheptane-1,5-dione;yttrium.
Molecular Properties
| Compound Name | carbanide;3,3-dimethylheptane-1,5-dione;yttrium |
| PubChem CID | 157371416 |
| Molecular Formula | C10H18O2Y-2 |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | carbanide;3,3-dimethylheptane-1,5-dione;yttrium |
| SMILES | CCC(=O)CC(C)(C)C[C-]=O.[CH3-].[Y] |
| InChI | InChI=1S/C9H15O2.CH3.Y/c1-4-8(11)7-9(2,3)5-6-10;;/h4-5,7H2,1-3H3;1H3;/q2*-1; |
| InChIKey | HLNAKMLBIJLNSC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3,3-dimethylheptane-1,5-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3,3-dimethylheptane-1,5-dione;yttrium?
The IUPAC name of carbanide;3,3-dimethylheptane-1,5-dione;yttrium (CID 157371416) is carbanide;3,3-dimethylheptane-1,5-dione;yttrium.
What is the SMILES notation for carbanide;3,3-dimethylheptane-1,5-dione;yttrium?
The canonical SMILES for carbanide;3,3-dimethylheptane-1,5-dione;yttrium is CCC(=O)CC(C)(C)C[C-]=O.[CH3-].[Y].
What is the InChIKey of carbanide;3,3-dimethylheptane-1,5-dione;yttrium?
The InChIKey is HLNAKMLBIJLNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O2.CH3.Y/c1-4-8(11)7-9(2,3)5-6-10;;/h4-5,7H2,1-3H3;1H3;/q2*-1;.
What are the key properties of carbanide;3,3-dimethylheptane-1,5-dione;yttrium?
carbanide;3,3-dimethylheptane-1,5-dione;yttrium has a molecular weight of 259.16 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3,3-dimethylheptane-1,5-dione;yttrium is sourced from PubChem (CID 157371416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).