C35H34N4O3 — CID 157377390
carbon dioxide;2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]indole-5-carboxamide (PubChem CID 157377390) has the molecular formula C35H34N4O3 and a molecular weight of 558.68 g/mol. Its IUPAC name is carbon dioxide;2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]indole-5-carboxamide.
| Compound Name | carbon dioxide;2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 157377390 |
| Molecular Formula | C35H34N4O3 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | carbon dioxide;2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1S)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)N[C@@H](C)c3cnc4c(c3)CCCN4)cc12.O=C=O |
| InChI | InChI=1S/C34H34N4O.CO2/c1-22-24(3)38(21-25-11-13-27(14-12-25)26-8-5-4-6-9-26)32-16-15-29(19-31(22)32)34(39)37-23(2)30-18-28-10-7-17-35-33(28)36-20-30;2-1-3/h4-6,8-9,11-16,18-20,23H,7,10,17,21H2,1-3H3,(H,35,36)(H,37,39);/t23-;/m0./s1 |
| InChIKey | BKMBMDCAJAKWIE-BQAIUKQQSA-N |
| XLogP | 6.63 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|