C27H26FN7 — CID 157383138
4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-6-fluoro-N-methyl-2-(1,5-naphthyridin-3-ylmethyl)-9H-indeno[2,1-d]pyrimidin-8-amine (PubChem CID 157383138) has the molecular formula C27H26FN7 and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-6-fluoro-N-methyl-2-(1,5-naphthyridin-3-ylmethyl)-9H-indeno[2,1-d]pyrimidin-8-amine.
| Compound Name | 4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-6-fluoro-N-methyl-2-(1,5-naphthyridin-3-ylmethyl)-9H-indeno[2,1-d]pyrimidin-8-amine |
|---|---|
| PubChem CID | 157383138 |
| Molecular Formula | C27H26FN7 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-6-fluoro-N-methyl-2-(1,5-naphthyridin-3-ylmethyl)-9H-indeno[2,1-d]pyrimidin-8-amine |
| SMILES | CNc1cc(F)cc2c1Cc1nc(Cc3cnc4cccnc4c3)nc(N3C[C@H]4CCN[C@H]4C3)c1-2 |
| InChI | InChI=1S/C27H26FN7/c1-29-21-10-17(28)9-19-18(21)11-23-26(19)27(35-13-16-4-6-31-24(16)14-35)34-25(33-23)8-15-7-22-20(32-12-15)3-2-5-30-22/h2-3,5,7,9-10,12,16,24,29,31H,4,6,8,11,13-14H2,1H3/t16-,24+/m1/s1 |
| InChIKey | JFIRVHOFCAXLEJ-GYCJOSAFSA-N |
| XLogP | 3.56 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |