C32H50O7 — CID 157384020
[(1R,2S,3R,4R,5S,7S,8S,9R,10S,12Z,14S,17R)-10-butanoyloxy-2,4,7,8,9,12,17-heptamethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] pentanoate (PubChem CID 157384020) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5S,7S,8S,9R,10S,12Z,14S,17R)-10-butanoyloxy-2,4,7,8,9,12,17-heptamethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] pentanoate.
| Compound Name | [(1R,2S,3R,4R,5S,7S,8S,9R,10S,12Z,14S,17R)-10-butanoyloxy-2,4,7,8,9,12,17-heptamethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] pentanoate |
|---|---|
| PubChem CID | 157384020 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | [(1R,2S,3R,4R,5S,7S,8S,9R,10S,12Z,14S,17R)-10-butanoyloxy-2,4,7,8,9,12,17-heptamethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-5-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@H]1C[C@H](C)[C@@]2(C)[C@H]([C@H]1C)[C@H](C)[C@]13O[C@@]1(C)C(=O)O[C@H]3/C=C(/C)C[C@H](OC(=O)CCC)[C@@H]2C |
| InChI | InChI=1S/C32H50O7/c1-10-12-14-27(34)36-23-17-19(4)30(8)21(6)24(37-26(33)13-11-2)15-18(3)16-25-32(22(7)28(30)20(23)5)31(9,39-32)29(35)38-25/h16,19-25,28H,10-15,17H2,1-9H3/b18-16-/t19-,20-,21-,22-,23-,24-,25-,28+,30+,31-,32+/m0/s1 |
| InChIKey | DEEIKGQGYSIELN-IJYYQPOLSA-N |
| XLogP | 6.17 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|