C20H18FNO2S — CID 157385178
2-[(4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 157385178) has the molecular formula C20H18FNO2S and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-[(4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 157385178 |
| Molecular Formula | C20H18FNO2S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[(4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=N[C@@]2(c3ccccc3F)COC[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C20H18FNO2S/c21-17-9-5-4-8-16(17)20-13-24-11-15(20)12-25-19(22-20)10-18(23)14-6-2-1-3-7-14/h1-9,15H,10-13H2/t15-,20-/m0/s1 |
| InChIKey | CBYKSYQZUZAWPL-YWZLYKJASA-N |
| XLogP | 4.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |