C37H58N4O8S — CID 157390730
5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]-N-[2-[2-[2-[2-[3-oxo-3-[[1-(4-propan-2-ylbenzoyl)piperidin-3-yl]amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 157390730) has the molecular formula C37H58N4O8S and a molecular weight of 718.96 g/mol. Its IUPAC name is 5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]-N-[2-[2-[2-[2-[3-oxo-3-[[1-(4-propan-2-ylbenzoyl)piperidin-3-yl]amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]-N-[2-[2-[2-[2-[3-oxo-3-[[1-(4-propan-2-ylbenzoyl)piperidin-3-yl]amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 157390730 |
| Molecular Formula | C37H58N4O8S |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | 5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]-N-[2-[2-[2-[2-[3-oxo-3-[[1-(4-propan-2-ylbenzoyl)piperidin-3-yl]amino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CC(C)c1ccc(C(=O)N2CCCC(NC(=O)CCOCCOCCOCCOCCNC(=O)CCCC[C@@H]3SCC4NC(=O)CC43)C2)cc1 |
| InChI | InChI=1S/C37H58N4O8S/c1-27(2)28-9-11-29(12-10-28)37(45)41-15-5-6-30(25-41)39-35(43)13-16-46-18-20-48-22-23-49-21-19-47-17-14-38-34(42)8-4-3-7-33-31-24-36(44)40-32(31)26-50-33/h9-12,27,30-33H,3-8,13-26H2,1-2H3,(H,38,42)(H,39,43)(H,40,44)/t30?,31?,32?,33-/m0/s1 |
| InChIKey | BLYWMUYYTUWOLP-FPOPRHALSA-N |
| XLogP | 3.28 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|