C18H23Cl2IN2O3 — CID 157397748
tert-butyl 4-[3-(4,5-dichloro-2-iodophenyl)propanoyl]piperazine-1-carboxylate (PubChem CID 157397748) has the molecular formula C18H23Cl2IN2O3 and a molecular weight of 513.20 g/mol. Its IUPAC name is tert-butyl 4-[3-(4,5-dichloro-2-iodophenyl)propanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4,5-dichloro-2-iodophenyl)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 157397748 |
| Molecular Formula | C18H23Cl2IN2O3 |
| Molecular Weight | 513.20 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | tert-butyl 4-[3-(4,5-dichloro-2-iodophenyl)propanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCc2cc(Cl)c(Cl)cc2I)CC1 |
| InChI | InChI=1S/C18H23Cl2IN2O3/c1-18(2,3)26-17(25)23-8-6-22(7-9-23)16(24)5-4-12-10-13(19)14(20)11-15(12)21/h10-11H,4-9H2,1-3H3 |
| InChIKey | CSOUXAWJNJORLU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|