About 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate
4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate (PubChem CID 157398561) has the molecular formula C17H16F2N2O9
and a molecular weight of 430.32 g/mol. Its IUPAC name is 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate.
Molecular Properties
| Compound Name | 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate |
| PubChem CID | 157398561 |
| Molecular Formula | C17H16F2N2O9 |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate |
| SMILES | COCC(Oc1ccc(F)c([N+](=O)[O-])c1)C(=O)OC.O=[N+]([O-])c1cc(O)ccc1F |
| InChI | InChI=1S/C11H12FNO6.C6H4FNO3/c1-17-6-10(11(14)18-2)19-7-3-4-8(12)9(5-7)13(15)16;7-5-2-1-4(9)3-6(5)8(10)11/h3-5,10H,6H2,1-2H3;1-3,9H |
| InChIKey | BMWJPNVALDUCMT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate?
The IUPAC name of 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate (CID 157398561) is 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate.
What is the SMILES notation for 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate?
The canonical SMILES for 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate is COCC(Oc1ccc(F)c([N+](=O)[O-])c1)C(=O)OC.O=[N+]([O-])c1cc(O)ccc1F.
What is the InChIKey of 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate?
The InChIKey is BMWJPNVALDUCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO6.C6H4FNO3/c1-17-6-10(11(14)18-2)19-7-3-4-8(12)9(5-7)13(15)16;7-5-2-1-4(9)3-6(5)8(10)11/h3-5,10H,6H2,1-2H3;1-3,9H.
What are the key properties of 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate?
4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate has a molecular weight of 430.32 g/mol, XLogP of 2.74, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-nitrophenol;methyl 2-(4-fluoro-3-nitrophenoxy)-3-methoxypropanoate is sourced from PubChem (CID 157398561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).