C32H56O14Zr — CID 157401809
bis(2,2,3-tributoxybutanedioate);zirconium(4+) (PubChem CID 157401809) has the molecular formula C32H56O14Zr and a molecular weight of 756.01 g/mol. Its IUPAC name is bis(2,2,3-tributoxybutanedioate);zirconium(4+).
| Compound Name | bis(2,2,3-tributoxybutanedioate);zirconium(4+) |
|---|---|
| PubChem CID | 157401809 |
| Molecular Formula | C32H56O14Zr |
| Molecular Weight | 756.01 g/mol |
| Exact Mass | 754.27 |
| IUPAC Name | bis(2,2,3-tributoxybutanedioate);zirconium(4+) |
| SMILES | CCCCOC(C(=O)[O-])C(OCCCC)(OCCCC)C(=O)[O-].CCCCOC(C(=O)[O-])C(OCCCC)(OCCCC)C(=O)[O-].[Zr+4] |
| InChI | InChI=1S/2C16H30O7.Zr/c2*1-4-7-10-21-13(14(17)18)16(15(19)20,22-11-8-5-2)23-12-9-6-3;/h2*13H,4-12H2,1-3H3,(H,17,18)(H,19,20);/q;;+4/p-4 |
| InChIKey | BNGIPIPRUAMFFZ-UHFFFAOYSA-J |
| XLogP | -0.00 |
| TPSA | 215.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.01 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|