C42H54N5+ — CID 157405885
1-(3-aminopropyl)-2-[3-[3'-(3-aminopropyl)-1',1'-dimethylspiro[cyclopentane-1,6'-indeno[1,2-e]indol-3-ium]-2'-yl]prop-2-enylidene]-N,N,3,3-tetramethylindol-5-amine (PubChem CID 157405885) has the molecular formula C42H54N5+ and a molecular weight of 628.93 g/mol. Its IUPAC name is 1-(3-aminopropyl)-2-[3-[3'-(3-aminopropyl)-1',1'-dimethylspiro[cyclopentane-1,6'-indeno[1,2-e]indol-3-ium]-2'-yl]prop-2-enylidene]-N,N,3,3-tetramethylindol-5-amine.
| Compound Name | 1-(3-aminopropyl)-2-[3-[3'-(3-aminopropyl)-1',1'-dimethylspiro[cyclopentane-1,6'-indeno[1,2-e]indol-3-ium]-2'-yl]prop-2-enylidene]-N,N,3,3-tetramethylindol-5-amine |
|---|---|
| PubChem CID | 157405885 |
| Molecular Formula | C42H54N5+ |
| Molecular Weight | 628.93 g/mol |
| Exact Mass | 628.44 |
| IUPAC Name | 1-(3-aminopropyl)-2-[3-[3'-(3-aminopropyl)-1',1'-dimethylspiro[cyclopentane-1,6'-indeno[1,2-e]indol-3-ium]-2'-yl]prop-2-enylidene]-N,N,3,3-tetramethylindol-5-amine |
| SMILES | CN(C)c1ccc2c(c1)C(C)(C)C(=CC=CC1=[N+](CCCN)c3ccc4c(c3C1(C)C)-c1ccccc1C41CCCC1)N2CCCN |
| InChI | InChI=1S/C42H54N5/c1-40(2)33-28-29(45(5)6)18-20-34(33)46(26-12-24-43)36(40)16-11-17-37-41(3,4)39-35(47(37)27-13-25-44)21-19-32-38(39)30-14-7-8-15-31(30)42(32)22-9-10-23-42/h7-8,11,14-21,28H,9-10,12-13,22-27,43-44H2,1-6H3/q+1 |
| InChIKey | BNSCJGOTCUOBIR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.93 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|