C47H47Cl4N7 — CID 157406360
2-N-[7-[8-amino-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2-yl]heptyl]-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2,8-diamine dichloride (PubChem CID 157406360) has the molecular formula C47H47Cl4N7 and a molecular weight of 851.75 g/mol. Its IUPAC name is 2-N-[7-[8-amino-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2-yl]heptyl]-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2,8-diamine dichloride.
| Compound Name | 2-N-[7-[8-amino-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2-yl]heptyl]-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2,8-diamine dichloride |
|---|---|
| PubChem CID | 157406360 |
| Molecular Formula | C47H47Cl4N7 |
| Molecular Weight | 851.75 g/mol |
| Exact Mass | 849.26 |
| IUPAC Name | 2-N-[7-[8-amino-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2-yl]heptyl]-10-(4-chlorophenyl)-3,7-dimethylphenazin-10-ium-2,8-diamine dichloride |
| SMILES | Cc1cc2nc3cc(C)c(CCCCCCCNc4cc5c(cc4C)nc4cc(C)c(N)cc4[n+]5-c4ccc(Cl)cc4)cc3[n+](-c3ccc(Cl)cc3)c2cc1N.[Cl-].[Cl-] |
| InChI | InChI=1S/C47H45Cl2N7.2ClH/c1-28-20-40-44(55(35-15-11-33(48)12-16-35)45-25-37(50)29(2)21-41(45)53-40)24-32(28)10-8-6-5-7-9-19-52-39-27-47-43(23-31(39)4)54-42-22-30(3)38(51)26-46(42)56(47)36-17-13-34(49)14-18-36;;/h11-18,20-27,50H,5-10,19H2,1-4H3,(H2,51,52);2*1H |
| InChIKey | AZCQKSJLXALWAV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|