C37H38N2O5 — CID 157407746
4-(4-butoxyphenyl)phenol;[4-[[4-(3-methyl-2-oxobut-3-enyl)phenyl]diazenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 157407746) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)phenol;[4-[[4-(3-methyl-2-oxobut-3-enyl)phenyl]diazenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | 4-(4-butoxyphenyl)phenol;[4-[[4-(3-methyl-2-oxobut-3-enyl)phenyl]diazenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157407746 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 4-(4-butoxyphenyl)phenol;[4-[[4-(3-methyl-2-oxobut-3-enyl)phenyl]diazenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Cc1ccc(/N=N/c2ccc(OC(=O)C(=C)C)cc2)cc1.CCCCOc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O3.C16H18O2/c1-14(2)20(24)13-16-5-7-17(8-6-16)22-23-18-9-11-19(12-10-18)26-21(25)15(3)4;1-2-3-12-18-16-10-6-14(7-11-16)13-4-8-15(17)9-5-13/h5-12H,1,3,13H2,2,4H3;4-11,17H,2-3,12H2,1H3/b23-22+; |
| InChIKey | BNXPMLCBEHZMOB-PGCQSHBKSA-N |
| XLogP | 9.51 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|