C32H34N4O3 — CID 157418250
N-butyl-5-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]pyrazine-2-carboxamide (PubChem CID 157418250) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-butyl-5-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]pyrazine-2-carboxamide.
| Compound Name | N-butyl-5-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 157418250 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-butyl-5-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]pyrazine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cnc(-c2cc3c(CCc4ccccc4)c(C(=O)CC4CC4)cnc3cc2OC)cn1 |
| InChI | InChI=1S/C32H34N4O3/c1-3-4-14-33-32(38)29-20-35-28(19-36-29)25-16-24-23(13-12-21-8-6-5-7-9-21)26(30(37)15-22-10-11-22)18-34-27(24)17-31(25)39-2/h5-9,16-20,22H,3-4,10-15H2,1-2H3,(H,33,38) |
| InChIKey | HLIJWMIEDKQEKG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|