C34H37N3O4 — CID 161072637
N-butyl-6-[3-(2-cyclopropylacetyl)-4-[2-[4-(hydroxymethyl)phenyl]ethyl]-7-methoxyquinolin-6-yl]pyridine-3-carboxamide (PubChem CID 161072637) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is N-butyl-6-[3-(2-cyclopropylacetyl)-4-[2-[4-(hydroxymethyl)phenyl]ethyl]-7-methoxyquinolin-6-yl]pyridine-3-carboxamide.
| Compound Name | N-butyl-6-[3-(2-cyclopropylacetyl)-4-[2-[4-(hydroxymethyl)phenyl]ethyl]-7-methoxyquinolin-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 161072637 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-butyl-6-[3-(2-cyclopropylacetyl)-4-[2-[4-(hydroxymethyl)phenyl]ethyl]-7-methoxyquinolin-6-yl]pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(-c2cc3c(CCc4ccc(CO)cc4)c(C(=O)CC4CC4)cnc3cc2OC)nc1 |
| InChI | InChI=1S/C34H37N3O4/c1-3-4-15-35-34(40)25-12-14-30(36-19-25)28-17-27-26(13-11-22-5-9-24(21-38)10-6-22)29(32(39)16-23-7-8-23)20-37-31(27)18-33(28)41-2/h5-6,9-10,12,14,17-20,23,38H,3-4,7-8,11,13,15-16,21H2,1-2H3,(H,35,40) |
| InChIKey | CNPNIBIIXOGPQG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|