C34H35FN2O3 — CID 159668125
N-butyl-4-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]-2-fluorobenzamide (PubChem CID 159668125) has the molecular formula C34H35FN2O3 and a molecular weight of 538.66 g/mol. Its IUPAC name is N-butyl-4-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]-2-fluorobenzamide.
| Compound Name | N-butyl-4-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 159668125 |
| Molecular Formula | C34H35FN2O3 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-butyl-4-[3-(2-cyclopropylacetyl)-7-methoxy-4-(2-phenylethyl)quinolin-6-yl]-2-fluorobenzamide |
| SMILES | CCCCNC(=O)c1ccc(-c2cc3c(CCc4ccccc4)c(C(=O)CC4CC4)cnc3cc2OC)cc1F |
| InChI | InChI=1S/C34H35FN2O3/c1-3-4-16-36-34(39)26-15-13-24(18-30(26)35)27-19-28-25(14-12-22-8-6-5-7-9-22)29(32(38)17-23-10-11-23)21-37-31(28)20-33(27)40-2/h5-9,13,15,18-21,23H,3-4,10-12,14,16-17H2,1-2H3,(H,36,39) |
| InChIKey | QYOPMUSTAORMJY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|