C31H34N4O2 — CID 159147203
5-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-butylpyrazine-2-carboxamide (PubChem CID 159147203) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 5-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-butylpyrazine-2-carboxamide.
| Compound Name | 5-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-butylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 159147203 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 5-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-butylpyrazine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cnc(-c2ccc3ncc(C(=O)CC(C)(C)C)c(Cc4ccccc4)c3c2)cn1 |
| InChI | InChI=1S/C31H34N4O2/c1-5-6-14-32-30(37)28-20-34-27(19-35-28)22-12-13-26-24(16-22)23(15-21-10-8-7-9-11-21)25(18-33-26)29(36)17-31(2,3)4/h7-13,16,18-20H,5-6,14-15,17H2,1-4H3,(H,32,37) |
| InChIKey | FRGIIKDDSJWBLQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|