C34H38N2O3 — CID 160671362
4-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-(2-propoxyethyl)benzamide (PubChem CID 160671362) has the molecular formula C34H38N2O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is 4-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-(2-propoxyethyl)benzamide.
| Compound Name | 4-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-(2-propoxyethyl)benzamide |
|---|---|
| PubChem CID | 160671362 |
| Molecular Formula | C34H38N2O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 4-[4-benzyl-3-(3,3-dimethylbutanoyl)quinolin-6-yl]-N-(2-propoxyethyl)benzamide |
| SMILES | CCCOCCNC(=O)c1ccc(-c2ccc3ncc(C(=O)CC(C)(C)C)c(Cc4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C34H38N2O3/c1-5-18-39-19-17-35-33(38)26-13-11-25(12-14-26)27-15-16-31-29(21-27)28(20-24-9-7-6-8-10-24)30(23-36-31)32(37)22-34(2,3)4/h6-16,21,23H,5,17-20,22H2,1-4H3,(H,35,38) |
| InChIKey | KSXFSJLAJWDUEC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|