C26H19N3O2 — CID 157419459
4-[(E)-[(3E)-3-[(4-isocyanophenyl)methylidene]-2-oxo-7-prop-2-enoyl-7-azaspiro[3.4]octan-1-ylidene]methyl]benzonitrile (PubChem CID 157419459) has the molecular formula C26H19N3O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 4-[(E)-[(3E)-3-[(4-isocyanophenyl)methylidene]-2-oxo-7-prop-2-enoyl-7-azaspiro[3.4]octan-1-ylidene]methyl]benzonitrile.
| Compound Name | 4-[(E)-[(3E)-3-[(4-isocyanophenyl)methylidene]-2-oxo-7-prop-2-enoyl-7-azaspiro[3.4]octan-1-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 157419459 |
| Molecular Formula | C26H19N3O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[(E)-[(3E)-3-[(4-isocyanophenyl)methylidene]-2-oxo-7-prop-2-enoyl-7-azaspiro[3.4]octan-1-ylidene]methyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(/C=C2/C(=O)/C(=C/c3ccc(C#N)cc3)C23CCN(C(=O)C=C)C3)cc1 |
| InChI | InChI=1S/C26H19N3O2/c1-3-24(30)29-13-12-26(17-29)22(14-18-4-6-20(16-27)7-5-18)25(31)23(26)15-19-8-10-21(28-2)11-9-19/h3-11,14-15H,1,12-13,17H2/b22-14-,23-15- |
| InChIKey | OGLZBEKTRTVIKL-VMTNTFKOSA-N |
| XLogP | 4.56 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|