C50H55F10NO10S3 — CID 157424755
bis[2-methoxy-3-[2-(2-methyl-1-adamantyl)acetyl]oxyphenyl]-phenylsulfanium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide (PubChem CID 157424755) has the molecular formula C50H55F10NO10S3 and a molecular weight of 1116.17 g/mol. Its IUPAC name is bis[2-methoxy-3-[2-(2-methyl-1-adamantyl)acetyl]oxyphenyl]-phenylsulfanium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide.
| Compound Name | bis[2-methoxy-3-[2-(2-methyl-1-adamantyl)acetyl]oxyphenyl]-phenylsulfanium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide |
|---|---|
| PubChem CID | 157424755 |
| Molecular Formula | C50H55F10NO10S3 |
| Molecular Weight | 1116.17 g/mol |
| Exact Mass | 1115.28 |
| IUPAC Name | bis[2-methoxy-3-[2-(2-methyl-1-adamantyl)acetyl]oxyphenyl]-phenylsulfanium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide |
| SMILES | COc1c(OC(=O)CC23CC4CC(CC(C4)C2C)C3)cccc1[S+](c1ccccc1)c1cccc(OC(=O)CC23CC4CC(CC(C4)C2C)C3)c1OC.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C46H55O6S.C4F10NO4S2/c1-28-34-18-30-16-31(19-34)23-45(28,22-30)26-41(47)51-37-12-8-14-39(43(37)49-3)53(36-10-6-5-7-11-36)40-15-9-13-38(44(40)50-4)52-42(48)27-46-24-32-17-33(25-46)21-35(20-32)29(46)2;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h5-15,28-35H,16-27H2,1-4H3;/q+1;-1 |
| InChIKey | BPVFWIFIUKMVAR-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 153.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1116.17 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|