C43H50F3O6S2+ — CID 88851039
2-[2-(adamantane-1-carbonyloxy)-2-(1-adamantyl)ethoxy]-1,1-difluoroethanesulfonic acid;(2-fluorophenyl)-diphenylsulfanium (PubChem CID 88851039) has the molecular formula C43H50F3O6S2+ and a molecular weight of 784.00 g/mol. Its IUPAC name is 2-[2-(adamantane-1-carbonyloxy)-2-(1-adamantyl)ethoxy]-1,1-difluoroethanesulfonic acid;(2-fluorophenyl)-diphenylsulfanium.
| Compound Name | 2-[2-(adamantane-1-carbonyloxy)-2-(1-adamantyl)ethoxy]-1,1-difluoroethanesulfonic acid;(2-fluorophenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 88851039 |
| Molecular Formula | C43H50F3O6S2+ |
| Molecular Weight | 784.00 g/mol |
| Exact Mass | 783.30 |
| IUPAC Name | 2-[2-(adamantane-1-carbonyloxy)-2-(1-adamantyl)ethoxy]-1,1-difluoroethanesulfonic acid;(2-fluorophenyl)-diphenylsulfanium |
| SMILES | Fc1ccccc1[S+](c1ccccc1)c1ccccc1.O=C(OC(COCC(F)(F)S(=O)(=O)O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H36F2O6S.C18H14FS/c26-25(27,34(29,30)31)14-32-13-21(23-7-15-1-16(8-23)3-17(2-15)9-23)33-22(28)24-10-18-4-19(11-24)6-20(5-18)12-24;19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h15-21H,1-14H2,(H,29,30,31);1-14H/q;+1 |
| InChIKey | DLOQKOZOILWYLF-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.00 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|