C20H27BN2O3 — CID 157426072
1-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 157426072) has the molecular formula C20H27BN2O3 and a molecular weight of 354.26 g/mol. Its IUPAC name is 1-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 157426072 |
| Molecular Formula | C20H27BN2O3 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@H]1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C20H27BN2O3/c1-13(24)23-10-6-7-18(23)17-12-14-11-15(8-9-16(14)22-17)21-25-19(2,3)20(4,5)26-21/h8-9,11,18H,6-7,10,12H2,1-5H3/t18-/m0/s1 |
| InChIKey | TUIRFQDFWWBGTJ-SFHVURJKSA-N |
| XLogP | 2.63 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|