About 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one
5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one (PubChem CID 157431532) has the molecular formula C21H23ClOS
and a molecular weight of 358.93 g/mol. Its IUPAC name is 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one.
Molecular Properties
| Compound Name | 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one |
| PubChem CID | 157431532 |
| Molecular Formula | C21H23ClOS |
| Molecular Weight | 358.93 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one |
| SMILES | CS(C)(Cl)CCCCC(=O)c1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C21H23ClOS/c1-24(2,22)14-6-5-9-21(23)18-13-12-17-11-10-16-7-3-4-8-19(16)20(17)15-18/h3-4,7-8,10-13,15H,5-6,9,14H2,1-2H3 |
| InChIKey | KDBJLOMUYGNOFM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.93 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one?
The IUPAC name of 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one (CID 157431532) is 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one.
What is the SMILES notation for 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one?
The canonical SMILES for 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one is CS(C)(Cl)CCCCC(=O)c1ccc2ccc3ccccc3c2c1.
What is the InChIKey of 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one?
The InChIKey is KDBJLOMUYGNOFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClOS/c1-24(2,22)14-6-5-9-21(23)18-13-12-17-11-10-16-7-3-4-8-19(16)20(17)15-18/h3-4,7-8,10-13,15H,5-6,9,14H2,1-2H3.
What are the key properties of 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one?
5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one has a molecular weight of 358.93 g/mol, XLogP of 6.56, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[chloro(dimethyl)-λ4-sulfanyl]-1-phenanthren-3-ylpentan-1-one is sourced from PubChem (CID 157431532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).