C29H47N5O9 — CID 157431929
bis(3-(5,5-dimethyl-2-oxooxolan-3-yl)-5,5-dimethylimidazolidine-2,4-dione);heptanamide (PubChem CID 157431929) has the molecular formula C29H47N5O9 and a molecular weight of 609.72 g/mol. Its IUPAC name is bis(3-(5,5-dimethyl-2-oxooxolan-3-yl)-5,5-dimethylimidazolidine-2,4-dione);heptanamide.
| Compound Name | bis(3-(5,5-dimethyl-2-oxooxolan-3-yl)-5,5-dimethylimidazolidine-2,4-dione);heptanamide |
|---|---|
| PubChem CID | 157431929 |
| Molecular Formula | C29H47N5O9 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | bis(3-(5,5-dimethyl-2-oxooxolan-3-yl)-5,5-dimethylimidazolidine-2,4-dione);heptanamide |
| SMILES | CC1(C)CC(N2C(=O)NC(C)(C)C2=O)C(=O)O1.CC1(C)CC(N2C(=O)NC(C)(C)C2=O)C(=O)O1.CCCCCCC(N)=O |
| InChI | InChI=1S/2C11H16N2O4.C7H15NO/c2*1-10(2)5-6(7(14)17-10)13-8(15)11(3,4)12-9(13)16;1-2-3-4-5-6-7(8)9/h2*6H,5H2,1-4H3,(H,12,16);2-6H2,1H3,(H2,8,9) |
| InChIKey | BQQHORVDMCKLJS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 194.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|