C11H14F3N3O6P+ — CID 157435562
[(1R,3R,4R,7S)-3-(6-amino-5-fluoro-2-oxo-1,6-dihydropyrimidin-3-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium (PubChem CID 157435562) has the molecular formula C11H14F3N3O6P+ and a molecular weight of 372.22 g/mol. Its IUPAC name is [(1R,3R,4R,7S)-3-(6-amino-5-fluoro-2-oxo-1,6-dihydropyrimidin-3-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium.
| Compound Name | [(1R,3R,4R,7S)-3-(6-amino-5-fluoro-2-oxo-1,6-dihydropyrimidin-3-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 157435562 |
| Molecular Formula | C11H14F3N3O6P+ |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | [(1R,3R,4R,7S)-3-(6-amino-5-fluoro-2-oxo-1,6-dihydropyrimidin-3-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
| SMILES | C[P+](=O)OC[C@]12O[C@@H](N3C=C(F)C(N)NC3=O)[C@H](OC1(F)F)[C@@H]2O |
| InChI | InChI=1S/C11H13F3N3O6P/c1-24(20)21-3-10-6(18)5(22-11(10,13)14)8(23-10)17-2-4(12)7(15)16-9(17)19/h2,5-8,18H,3,15H2,1H3/p+1/t5-,6+,7?,8-,10-/m1/s1 |
| InChIKey | MNINONBXLKVLSG-YFPSEZNUSA-O |
| XLogP | -0.06 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|