C28H39BN2O5 — CID 157451746
methyl 4-methyl-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carbonyl]pentanoate (PubChem CID 157451746) has the molecular formula C28H39BN2O5 and a molecular weight of 494.44 g/mol. Its IUPAC name is methyl 4-methyl-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carbonyl]pentanoate.
| Compound Name | methyl 4-methyl-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carbonyl]pentanoate |
|---|---|
| PubChem CID | 157451746 |
| Molecular Formula | C28H39BN2O5 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | methyl 4-methyl-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carbonyl]pentanoate |
| SMILES | COC(=O)CC(C(=O)N1C2CCC(C2)C1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1)C(C)C |
| InChI | InChI=1S/C28H39BN2O5/c1-16(2)21(15-24(32)34-7)26(33)31-20-10-8-17(13-20)25(31)23-14-18-12-19(9-11-22(18)30-23)29-35-27(3,4)28(5,6)36-29/h9,11-12,16-17,20-21,25H,8,10,13-15H2,1-7H3 |
| InChIKey | YSZYAURRTMCMDU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|