C25H35BN2O4 — CID 76818814
tert-butyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 76818814) has the molecular formula C25H35BN2O4 and a molecular weight of 438.38 g/mol. Its IUPAC name is tert-butyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 76818814 |
| Molecular Formula | C25H35BN2O4 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | tert-butyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC(C2)C1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C25H35BN2O4/c1-23(2,3)30-22(29)28-18-10-8-15(13-18)21(28)20-14-16-12-17(9-11-19(16)27-20)26-31-24(4,5)25(6,7)32-26/h9,11-12,15,18,21H,8,10,13-14H2,1-7H3 |
| InChIKey | JCYZWOJFPPQVGH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|