C28H39BN2O4 — CID 157102858
2-propan-2-yl-1-[(1R,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]pentane-1,4-dione (PubChem CID 157102858) has the molecular formula C28H39BN2O4 and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-propan-2-yl-1-[(1R,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]pentane-1,4-dione.
| Compound Name | 2-propan-2-yl-1-[(1R,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 157102858 |
| Molecular Formula | C28H39BN2O4 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 2-propan-2-yl-1-[(1R,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]pentane-1,4-dione |
| SMILES | CC(=O)CC(C(=O)N1C(C2=Nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3C2)[C@H]2CC[C@@H]1C2)C(C)C |
| InChI | InChI=1S/C28H39BN2O4/c1-16(2)22(12-17(3)32)26(33)31-21-10-8-18(14-21)25(31)24-15-19-13-20(9-11-23(19)30-24)29-34-27(4,5)28(6,7)35-29/h9,11,13,16,18,21-22,25H,8,10,12,14-15H2,1-7H3/t18-,21+,22?,25?/m0/s1 |
| InChIKey | KYLGMQQDRMSUMD-QULFDCOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|