About 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane)
3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) (PubChem CID 157452011) has the molecular formula C18H19BrN4O4
and a molecular weight of 439.29 g/mol. Its IUPAC name is 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane).
Molecular Properties
| Compound Name | 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) |
| PubChem CID | 157452011 |
| Molecular Formula | C18H19BrN4O4 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) |
| SMILES | O=[N+]([O-])c1cccc2[nH]cc(Br)c12.O=[N+]([O-])c1cccc2[nH]ccc12.[3H]C.[3H]C |
| InChI | InChI=1S/C8H5BrN2O2.C8H6N2O2.2CH4/c9-5-4-10-6-2-1-3-7(8(5)6)11(12)13;11-10(12)8-3-1-2-7-6(8)4-5-9-7;;/h1-4,10H;1-5,9H;2*1H4/i;;2*1T |
| InChIKey | BSXKCCFDPXCVBG-MLMGVMGHSA-N |
| XLogP | 6.19 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane)?
The IUPAC name of 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) (CID 157452011) is 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane).
What is the SMILES notation for 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane)?
The canonical SMILES for 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) is O=[N+]([O-])c1cccc2[nH]cc(Br)c12.O=[N+]([O-])c1cccc2[nH]ccc12.[3H]C.[3H]C.
What is the InChIKey of 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane)?
The InChIKey is BSXKCCFDPXCVBG-MLMGVMGHSA-N. The full InChI is InChI=1S/C8H5BrN2O2.C8H6N2O2.2CH4/c9-5-4-10-6-2-1-3-7(8(5)6)11(12)13;11-10(12)8-3-1-2-7-6(8)4-5-9-7;;/h1-4,10H;1-5,9H;2*1H4/i;;2*1T.
What are the key properties of 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane)?
3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) has a molecular weight of 439.29 g/mol, XLogP of 6.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-nitro-1H-indole;4-nitro-1H-indole;bis(tritiomethane) is sourced from PubChem (CID 157452011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).