C28H48O2 — CID 157454588
(2-ethyl-3,3-dimethylbutyl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 157454588) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (2-ethyl-3,3-dimethylbutyl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | (2-ethyl-3,3-dimethylbutyl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 157454588 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (2-ethyl-3,3-dimethylbutyl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(CC)C(C)(C)C |
| InChI | InChI=1S/C28H48O2/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27(29)30-25-26(7-2)28(3,4)5/h11-12,14-15,17-18,20-21,26H,6-10,13,16,19,22-25H2,1-5H3/b12-11-,15-14-,18-17-,21-20- |
| InChIKey | AWDJOALARKLGLL-FORXSXPXSA-N |
| XLogP | 8.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|