C24H36F6N5O8+ — CID 157454719
2-[2-[2-[2-[4-[(4-aminopiperidin-1-yl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]ethylimino-iminoazanium;bis(2,2,2-trifluoroacetic acid) (PubChem CID 157454719) has the molecular formula C24H36F6N5O8+ and a molecular weight of 636.57 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[(4-aminopiperidin-1-yl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]ethylimino-iminoazanium;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[2-[2-[2-[4-[(4-aminopiperidin-1-yl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]ethylimino-iminoazanium;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 157454719 |
| Molecular Formula | C24H36F6N5O8+ |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 2-[2-[2-[2-[4-[(4-aminopiperidin-1-yl)methyl]phenoxy]ethoxy]ethoxy]ethoxy]ethylimino-iminoazanium;bis(2,2,2-trifluoroacetic acid) |
| SMILES | N=[N+]=NCCOCCOCCOCCOc1ccc(CN2CCC(N)CC2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H34N5O4.2C2HF3O2/c21-19-5-8-25(9-6-19)17-18-1-3-20(4-2-18)29-16-15-28-14-13-27-12-11-26-10-7-23-24-22;2*3-2(4,5)1(6)7/h1-4,19,22H,5-17,21H2;2*(H,6,7)/q+1;; |
| InChIKey | QJSUVBGOIZTGDB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|