C36H44Br2N6 — CID 157455387
5-bromo-2-(3-phenylpropyl)-3,4-dihydro-1H-isoquinoline-7,8-diamine (PubChem CID 157455387) has the molecular formula C36H44Br2N6 and a molecular weight of 720.60 g/mol. Its IUPAC name is 5-bromo-2-(3-phenylpropyl)-3,4-dihydro-1H-isoquinoline-7,8-diamine.
| Compound Name | 5-bromo-2-(3-phenylpropyl)-3,4-dihydro-1H-isoquinoline-7,8-diamine |
|---|---|
| PubChem CID | 157455387 |
| Molecular Formula | C36H44Br2N6 |
| Molecular Weight | 720.60 g/mol |
| Exact Mass | 718.20 |
| IUPAC Name | 5-bromo-2-(3-phenylpropyl)-3,4-dihydro-1H-isoquinoline-7,8-diamine |
| SMILES | Nc1cc(Br)c2c(c1N)CN(CCCc1ccccc1)CC2.Nc1cc(Br)c2c(c1N)CN(CCCc1ccccc1)CC2 |
| InChI | InChI=1S/2C18H22BrN3/c2*19-16-11-17(20)18(21)15-12-22(10-8-14(15)16)9-4-7-13-5-2-1-3-6-13/h2*1-3,5-6,11H,4,7-10,12,20-21H2 |
| InChIKey | BTHGIHPYTKUXME-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.60 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|