C17H17BrF3N3 — CID 21253052
8-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-5,6-diamine (PubChem CID 21253052) has the molecular formula C17H17BrF3N3 and a molecular weight of 400.24 g/mol. Its IUPAC name is 8-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-5,6-diamine.
| Compound Name | 8-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-5,6-diamine |
|---|---|
| PubChem CID | 21253052 |
| Molecular Formula | C17H17BrF3N3 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 8-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-5,6-diamine |
| SMILES | Nc1cc(Br)c2c(c1N)CCN(Cc1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C17H17BrF3N3/c18-14-7-15(22)16(23)12-4-5-24(9-13(12)14)8-10-2-1-3-11(6-10)17(19,20)21/h1-3,6-7H,4-5,8-9,22-23H2 |
| InChIKey | JVIMMPRQZMKMHT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|