C19H16F3N3O2 — CID 18788226
9-[[3-(trifluoromethyl)phenyl]methyl]-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione (PubChem CID 18788226) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 9-[[3-(trifluoromethyl)phenyl]methyl]-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione.
| Compound Name | 9-[[3-(trifluoromethyl)phenyl]methyl]-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 18788226 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 9-[[3-(trifluoromethyl)phenyl]methyl]-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc3c(c2[nH]c1=O)CN(Cc1cccc(C(F)(F)F)c1)CC3 |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)13-3-1-2-11(8-13)9-25-7-6-12-4-5-15-16(14(12)10-25)24-18(27)17(26)23-15/h1-5,8H,6-7,9-10H2,(H,23,26)(H,24,27) |
| InChIKey | CMXVYBPLGVCJFM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|