C20H19F3N4O7S — CID 21253070
methanesulfonic acid;6-nitro-8-[[4-(trifluoromethyl)phenyl]methyl]-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione (PubChem CID 21253070) has the molecular formula C20H19F3N4O7S and a molecular weight of 516.45 g/mol. Its IUPAC name is methanesulfonic acid;6-nitro-8-[[4-(trifluoromethyl)phenyl]methyl]-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione.
| Compound Name | methanesulfonic acid;6-nitro-8-[[4-(trifluoromethyl)phenyl]methyl]-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 21253070 |
| Molecular Formula | C20H19F3N4O7S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | methanesulfonic acid;6-nitro-8-[[4-(trifluoromethyl)phenyl]methyl]-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione |
| SMILES | CS(=O)(=O)O.O=c1[nH]c2cc([N+](=O)[O-])c3c(c2[nH]c1=O)CCN(Cc1ccc(C(F)(F)F)cc1)C3 |
| InChI | InChI=1S/C19H15F3N4O4.CH4O3S/c20-19(21,22)11-3-1-10(2-4-11)8-25-6-5-12-13(9-25)15(26(29)30)7-14-16(12)24-18(28)17(27)23-14;1-5(2,3)4/h1-4,7H,5-6,8-9H2,(H,23,27)(H,24,28);1H3,(H,2,3,4) |
| InChIKey | HFABZJYKMDCSQV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 166.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|