C17H30O10S — CID 157461976
3-methyl-2-oxobutane-1-sulfonic acid;bis(4-methyl-3-oxopentanoic acid) (PubChem CID 157461976) has the molecular formula C17H30O10S and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-methyl-2-oxobutane-1-sulfonic acid;bis(4-methyl-3-oxopentanoic acid).
| Compound Name | 3-methyl-2-oxobutane-1-sulfonic acid;bis(4-methyl-3-oxopentanoic acid) |
|---|---|
| PubChem CID | 157461976 |
| Molecular Formula | C17H30O10S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-methyl-2-oxobutane-1-sulfonic acid;bis(4-methyl-3-oxopentanoic acid) |
| SMILES | CC(C)C(=O)CC(=O)O.CC(C)C(=O)CC(=O)O.CC(C)C(=O)CS(=O)(=O)O |
| InChI | InChI=1S/2C6H10O3.C5H10O4S/c2*1-4(2)5(7)3-6(8)9;1-4(2)5(6)3-10(7,8)9/h2*4H,3H2,1-2H3,(H,8,9);4H,3H2,1-2H3,(H,7,8,9) |
| InChIKey | BUALFPMJGACYBO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|